ChemNet > CAS > 423768-54-1 2-morpholinonicotinic acid
423768-54-1 2-morpholinonicotinic acid
| Produkt-Name |
2-morpholinonicotinic acid |
| Synonyme |
2-morpholin-4-ylpyridine-3-carboxylic acid |
| Molekulare Formel |
C10H12N2O3 |
| Molecular Weight |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-2-1-3-11-9(8)12-4-6-15-7-5-12/h1-3H,4-7H2,(H,13,14) |
| CAS Registry Number |
423768-54-1 |
| Molecular Structure |
|
| Dichte |
1.313g/cm3 |
| Schmelzpunkt |
130℃ |
| Siedepunkt |
418°C at 760 mmHg |
| Brechungsindex |
1.584 |
| Flammpunkt |
206.6°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
